![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Aliphatib bromo and iodo compounds.pdf | 09-Jun-2004 00:00 | 267K | |
| Aliphatic chloro compounds.pdf | 09-Jun-2004 00:01 | 205K | |
| Aliphatic fluoro compounds.pdf | 09-Jun-2004 00:01 | 201K | |
| Aliphatic ketones.pdf | 09-Jun-2004 00:01 | 184K | |
| C-C bond anisotropy and the methyl effect.pdf | 09-Jun-2004 00:01 | 286K | |
| C-C bond anisotropy investigation.pdf | 09-Jun-2004 00:01 | 212K | |
| Chemical shifts of acetylenes.pdf | 09-Jun-2004 00:01 | 245K | |
| Chemical shifts of alkenes.pdf | 09-Jun-2004 00:02 | 271K | |
| Chemical shifts of aromatic aldehydes and ketones.pdf | 09-Jun-2004 00:02 | 251K | |
| Chemical shifts of aromatic hydrocarbons and substituted benzenes.pdf | 09-Jun-2004 00:02 | 227K | |
| Chemical shifts of nitriles.pdf | 09-Jun-2004 00:02 | 210K | |
| Chemical shifts of substituted alkanes.pdf | 09-Jun-2004 00:02 | 316K | |
| Ethers.pdf | 09-Jun-2004 00:02 | 201K | |
| Ring currents and p-electron effects in hetero-aromatics .pdf | 09-Jun-2004 00:00 | 289K | |
| SCS1.pdf | 29-Feb-2008 13:47 | 686K | |
| SCS2.pdf | 29-Feb-2008 13:47 | 922K | |
| SCS3.pdf | 29-Feb-2008 13:48 | 876K | |
| SCS4.pdf | 29-Feb-2008 13:48 | 1.0M | |
| SCS5.pdf | 28-Nov-2005 22:45 | 957K | |
| SCS6.pdf | 28-Nov-2005 22:46 | 1.1M | |
| SCS7.pdf | 28-Nov-2005 22:46 | 436K | |
| SCS8.pdf | 28-Nov-2005 22:46 | 361K | |
| SCS9.pdf | 28-Nov-2005 22:46 | 395K | |
| SCS10.pdf | 28-Nov-2005 22:46 | 143K | |
| SCS11.pdf | 28-Nov-2005 22:46 | 231K | |
| SCS12.pdf | 28-Nov-2005 22:47 | 124K | |
| SCS13.pdf | 28-Nov-2005 22:47 | 157K | |
| SCS14.pdf | 28-Nov-2005 22:47 | 174K | |
| SCS15.pdf | 28-Nov-2005 22:47 | 122K | |
| SCS16.pdf | 28-Nov-2005 22:47 | 165K | |
| SCS17.pdf | 28-Nov-2005 22:47 | 188K | |
| SCS18.pdf | 28-Nov-2005 22:47 | 179K | |
| SCS21.pdf | 28-Nov-2005 22:45 | 252K | |
| SCSPT22.pdf | 11-Oct-2007 11:34 | 241K | |
| SCSPT25.pdf | 11-Oct-2007 11:34 | 260K | |
| SCSPT26.pdf | 11-Oct-2007 11:34 | 186K | |
| SCSPt24.pdf | 11-Oct-2007 11:34 | 123K | |
| SCSpt23.pdf | 11-Oct-2007 11:34 | 220K | |
| Spectroscopy Europe Article.pdf | 11-Aug-2004 12:39 | 239K | |
| TD_18_1.pdf | 07-Mar-2006 17:24 | 1.0M | |
| The non active nature of fluro alkenes.pdf | 09-Jun-2004 00:00 | 73K | |
| Through space effects of halogens.pdf | 09-Jun-2004 00:01 | 270K | |
| nmrpredict/ | 18-Mar-2005 08:26 | - | |
| scs19.pdf | 28-Nov-2005 22:47 | 189K | |
| scs20.pdf | 28-Nov-2005 22:47 | 194K | |